C12H24O4Si2 — CID 15363036
dimethyl (Z)-2,3-bis(trimethylsilyl)but-2-enedioate (PubChem CID 15363036) has the molecular formula C12H24O4Si2 and a molecular weight of 288.49 g/mol. Its IUPAC name is dimethyl (Z)-2,3-bis(trimethylsilyl)but-2-enedioate.
| Compound Name | dimethyl (Z)-2,3-bis(trimethylsilyl)but-2-enedioate |
|---|---|
| PubChem CID | 15363036 |
| Molecular Formula | C12H24O4Si2 |
| Molecular Weight | 288.49 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | dimethyl (Z)-2,3-bis(trimethylsilyl)but-2-enedioate |
| SMILES | COC(=O)/C(=C(\C(=O)OC)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H24O4Si2/c1-15-11(13)9(17(3,4)5)10(12(14)16-2)18(6,7)8/h1-8H3/b10-9- |
| InChIKey | VIMHCTKPMKRHFR-KTKRTIGZSA-N |
| XLogP | 2.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|