C11H20O2Si2 — CID 10657709
5-methylidene-3,4-bis(trimethylsilyl)furan-2-one (PubChem CID 10657709) has the molecular formula C11H20O2Si2 and a molecular weight of 240.45 g/mol. Its IUPAC name is 5-methylidene-3,4-bis(trimethylsilyl)furan-2-one.
| Compound Name | 5-methylidene-3,4-bis(trimethylsilyl)furan-2-one |
|---|---|
| PubChem CID | 10657709 |
| Molecular Formula | C11H20O2Si2 |
| Molecular Weight | 240.45 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 5-methylidene-3,4-bis(trimethylsilyl)furan-2-one |
| SMILES | C=C1OC(=O)C([Si](C)(C)C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C11H20O2Si2/c1-8-9(14(2,3)4)10(11(12)13-8)15(5,6)7/h1H2,2-7H3 |
| InChIKey | AMPYYBMUYNKWKR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|