C12H16O2Si — CID 101146580
(5Z)-5-[(2E,4E)-5-trimethylsilylpenta-2,4-dienylidene]furan-2-one (PubChem CID 101146580) has the molecular formula C12H16O2Si and a molecular weight of 220.34 g/mol. Its IUPAC name is (5Z)-5-[(2E,4E)-5-trimethylsilylpenta-2,4-dienylidene]furan-2-one.
| Compound Name | (5Z)-5-[(2E,4E)-5-trimethylsilylpenta-2,4-dienylidene]furan-2-one |
|---|---|
| PubChem CID | 101146580 |
| Molecular Formula | C12H16O2Si |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (5Z)-5-[(2E,4E)-5-trimethylsilylpenta-2,4-dienylidene]furan-2-one |
| SMILES | C[Si](C)(C)/C=C/C=C/C=C1/C=CC(=O)O1 |
| InChI | InChI=1S/C12H16O2Si/c1-15(2,3)10-6-4-5-7-11-8-9-12(13)14-11/h4-10H,1-3H3/b5-4+,10-6+,11-7- |
| InChIKey | GVXLHLDHNVBFFC-QNUFCBGOSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|