C10H10O2 — CID 134862462
(5Z)-5-[(2E,4E)-hexa-2,4-dienylidene]furan-2-one (PubChem CID 134862462) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is (5Z)-5-[(2E,4E)-hexa-2,4-dienylidene]furan-2-one.
| Compound Name | (5Z)-5-[(2E,4E)-hexa-2,4-dienylidene]furan-2-one |
|---|---|
| PubChem CID | 134862462 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (5Z)-5-[(2E,4E)-hexa-2,4-dienylidene]furan-2-one |
| SMILES | C/C=C/C=C/C=C1/C=CC(=O)O1 |
| InChI | InChI=1S/C10H10O2/c1-2-3-4-5-6-9-7-8-10(11)12-9/h2-8H,1H3/b3-2+,5-4+,9-6- |
| InChIKey | AKCYGGHECABLLR-XDILRCPJSA-N |
| XLogP | 2.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|