C25H23N3O2 — CID 10834631
(4S,5S)-4-methyl-2-[6-[(4S,5S)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-5-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 10834631) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is (4S,5S)-4-methyl-2-[6-[(4S,5S)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-5-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5S)-4-methyl-2-[6-[(4S,5S)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-5-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 10834631 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (4S,5S)-4-methyl-2-[6-[(4S,5S)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-5-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | C[C@@H]1N=C(c2cccc(C3=N[C@@H](C)[C@H](c4ccccc4)O3)n2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H23N3O2/c1-16-22(18-10-5-3-6-11-18)29-24(26-16)20-14-9-15-21(28-20)25-27-17(2)23(30-25)19-12-7-4-8-13-19/h3-17,22-23H,1-2H3/t16-,17-,22+,23+/m0/s1 |
| InChIKey | WAQJMWVRZVOTCH-ZCVTWQBDSA-N |
| XLogP | 4.89 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |