C12H10N2O — CID 828047
2-quinolin-2-yl-4,5-dihydro-1,3-oxazole (PubChem CID 828047) has the molecular formula C12H10N2O and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-quinolin-2-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-quinolin-2-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 828047 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-quinolin-2-yl-4,5-dihydro-1,3-oxazole |
| SMILES | c1ccc2nc(C3=NCCO3)ccc2c1 |
| InChI | InChI=1S/C12H10N2O/c1-2-4-10-9(3-1)5-6-11(14-10)12-13-7-8-15-12/h1-6H,7-8H2 |
| InChIKey | USDSJWOYSHFPND-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |