C20H20FNO5S — CID 10835114
[(E)-2-methylsulfonyl-3-phenylprop-2-enyl] N-(1-fluoro-1-oxo-3-phenylpropan-2-yl)carbamate (PubChem CID 10835114) has the molecular formula C20H20FNO5S and a molecular weight of 405.45 g/mol. Its IUPAC name is [(E)-2-methylsulfonyl-3-phenylprop-2-enyl] N-(1-fluoro-1-oxo-3-phenylpropan-2-yl)carbamate.
| Compound Name | [(E)-2-methylsulfonyl-3-phenylprop-2-enyl] N-(1-fluoro-1-oxo-3-phenylpropan-2-yl)carbamate |
|---|---|
| PubChem CID | 10835114 |
| Molecular Formula | C20H20FNO5S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [(E)-2-methylsulfonyl-3-phenylprop-2-enyl] N-(1-fluoro-1-oxo-3-phenylpropan-2-yl)carbamate |
| SMILES | CS(=O)(=O)/C(=C/c1ccccc1)COC(=O)NC(Cc1ccccc1)C(=O)F |
| InChI | InChI=1S/C20H20FNO5S/c1-28(25,26)17(12-15-8-4-2-5-9-15)14-27-20(24)22-18(19(21)23)13-16-10-6-3-7-11-16/h2-12,18H,13-14H2,1H3,(H,22,24)/b17-12+ |
| InChIKey | PHVBXNVCRDGCAE-SFQUDFHCSA-N |
| XLogP | 2.91 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|