C13H20Br2N2O4 — CID 10836259
tert-butyl (4S)-3-(2,4-dibromobutanoyl)-1-methyl-2-oxoimidazolidine-4-carboxylate (PubChem CID 10836259) has the molecular formula C13H20Br2N2O4 and a molecular weight of 428.12 g/mol. Its IUPAC name is tert-butyl (4S)-3-(2,4-dibromobutanoyl)-1-methyl-2-oxoimidazolidine-4-carboxylate.
| Compound Name | tert-butyl (4S)-3-(2,4-dibromobutanoyl)-1-methyl-2-oxoimidazolidine-4-carboxylate |
|---|---|
| PubChem CID | 10836259 |
| Molecular Formula | C13H20Br2N2O4 |
| Molecular Weight | 428.12 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | tert-butyl (4S)-3-(2,4-dibromobutanoyl)-1-methyl-2-oxoimidazolidine-4-carboxylate |
| SMILES | CN1C[C@@H](C(=O)OC(C)(C)C)N(C(=O)C(Br)CCBr)C1=O |
| InChI | InChI=1S/C13H20Br2N2O4/c1-13(2,3)21-11(19)9-7-16(4)12(20)17(9)10(18)8(15)5-6-14/h8-9H,5-7H2,1-4H3/t8?,9-/m0/s1 |
| InChIKey | KWJGGUMPKPYNMJ-GKAPJAKFSA-N |
| XLogP | 2.14 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.12 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|