C25H32N4O3 — CID 10836686
(1R,2S,6R,7S)-4-[4-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]butyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 10836686) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-[4-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]butyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-4-[4-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]butyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 10836686 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (1R,2S,6R,7S)-4-[4-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]butyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C(=O)N1CCCCN1CCC(n2c(=O)[nH]c3ccccc32)CC1 |
| InChI | InChI=1S/C25H32N4O3/c30-23-21-16-7-8-17(15-16)22(21)24(31)28(23)12-4-3-11-27-13-9-18(10-14-27)29-20-6-2-1-5-19(20)26-25(29)32/h1-2,5-6,16-18,21-22H,3-4,7-15H2,(H,26,32)/t16-,17+,21+,22- |
| InChIKey | OICMOBDWEFOCHF-UWSKWSKGSA-N |
| XLogP | 2.78 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|