C20H30N4O — CID 172968501
3-[1-(3-piperidin-4-ylpropyl)piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 172968501) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is 3-[1-(3-piperidin-4-ylpropyl)piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-(3-piperidin-4-ylpropyl)piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 172968501 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 3-[1-(3-piperidin-4-ylpropyl)piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1C1CCN(CCCC2CCNCC2)CC1 |
| InChI | InChI=1S/C20H30N4O/c25-20-22-18-5-1-2-6-19(18)24(20)17-9-14-23(15-10-17)13-3-4-16-7-11-21-12-8-16/h1-2,5-6,16-17,21H,3-4,7-15H2,(H,22,25) |
| InChIKey | DHXLLPWZCCLJOF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |