C19H28Cl2N4O — CID 21076275
3-[1-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]piperidin-4-yl]-1H-benzimidazol-2-one;dihydrochloride (PubChem CID 21076275) has the molecular formula C19H28Cl2N4O and a molecular weight of 399.37 g/mol. Its IUPAC name is 3-[1-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]piperidin-4-yl]-1H-benzimidazol-2-one;dihydrochloride.
| Compound Name | 3-[1-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]piperidin-4-yl]-1H-benzimidazol-2-one;dihydrochloride |
|---|---|
| PubChem CID | 21076275 |
| Molecular Formula | C19H28Cl2N4O |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3-[1-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]piperidin-4-yl]-1H-benzimidazol-2-one;dihydrochloride |
| SMILES | Cl.Cl.O=c1[nH]c2ccccc2n1C1CCN(CCC2=CCNCC2)CC1 |
| InChI | InChI=1S/C19H26N4O.2ClH/c24-19-21-17-3-1-2-4-18(17)23(19)16-8-13-22(14-9-16)12-7-15-5-10-20-11-6-15;;/h1-5,16,20H,6-14H2,(H,21,24);2*1H |
| InChIKey | UNUNWWWADXKSPJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 53.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|