C20H23N3OS — CID 172968600
3-[1-(2-phenylsulfanylethyl)piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 172968600) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is 3-[1-(2-phenylsulfanylethyl)piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-(2-phenylsulfanylethyl)piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 172968600 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3-[1-(2-phenylsulfanylethyl)piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1C1CCN(CCSc2ccccc2)CC1 |
| InChI | InChI=1S/C20H23N3OS/c24-20-21-18-8-4-5-9-19(18)23(20)16-10-12-22(13-11-16)14-15-25-17-6-2-1-3-7-17/h1-9,16H,10-15H2,(H,21,24) |
| InChIKey | MVMGPCMWBCJSIV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |