C19H30N4O6S — CID 10836923
1-N-hexyl-3-N-hydroxy-4-(4-methoxyphenyl)sulfonylpiperazine-1,3-dicarboxamide (PubChem CID 10836923) has the molecular formula C19H30N4O6S and a molecular weight of 442.54 g/mol. Its IUPAC name is 1-N-hexyl-3-N-hydroxy-4-(4-methoxyphenyl)sulfonylpiperazine-1,3-dicarboxamide.
| Compound Name | 1-N-hexyl-3-N-hydroxy-4-(4-methoxyphenyl)sulfonylpiperazine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 10836923 |
| Molecular Formula | C19H30N4O6S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 1-N-hexyl-3-N-hydroxy-4-(4-methoxyphenyl)sulfonylpiperazine-1,3-dicarboxamide |
| SMILES | CCCCCCNC(=O)N1CCN(S(=O)(=O)c2ccc(OC)cc2)C(C(=O)NO)C1 |
| InChI | InChI=1S/C19H30N4O6S/c1-3-4-5-6-11-20-19(25)22-12-13-23(17(14-22)18(24)21-26)30(27,28)16-9-7-15(29-2)8-10-16/h7-10,17,26H,3-6,11-14H2,1-2H3,(H,20,25)(H,21,24) |
| InChIKey | ZFYWVXBCKVCYOL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|