C20H28N4O7S — CID 10504472
(2R,4S)-1-(4-butoxyphenyl)sulfonyl-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-hydroxypyrrolidine-2-carboxamide (PubChem CID 10504472) has the molecular formula C20H28N4O7S and a molecular weight of 468.53 g/mol. Its IUPAC name is (2R,4S)-1-(4-butoxyphenyl)sulfonyl-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-1-(4-butoxyphenyl)sulfonyl-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10504472 |
| Molecular Formula | C20H28N4O7S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | (2R,4S)-1-(4-butoxyphenyl)sulfonyl-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-hydroxypyrrolidine-2-carboxamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2C[C@@H](N3C(=O)NC(C)(C)C3=O)C[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C20H28N4O7S/c1-4-5-10-31-14-6-8-15(9-7-14)32(29,30)23-12-13(11-16(23)17(25)22-28)24-18(26)20(2,3)21-19(24)27/h6-9,13,16,28H,4-5,10-12H2,1-3H3,(H,21,27)(H,22,25)/t13-,16+/m0/s1 |
| InChIKey | QGTWMCXPSZIGIN-XJKSGUPXSA-N |
| XLogP | 0.83 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|