C30H33NO4 — CID 10838152
(7R,8R,9R,9aR)-7,8,9-tris(phenylmethoxy)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one (PubChem CID 10838152) has the molecular formula C30H33NO4 and a molecular weight of 471.60 g/mol. Its IUPAC name is (7R,8R,9R,9aR)-7,8,9-tris(phenylmethoxy)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one.
| Compound Name | (7R,8R,9R,9aR)-7,8,9-tris(phenylmethoxy)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
|---|---|
| PubChem CID | 10838152 |
| Molecular Formula | C30H33NO4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | (7R,8R,9R,9aR)-7,8,9-tris(phenylmethoxy)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
| SMILES | O=C1CCC[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)C(OCc3ccccc3)CN12 |
| InChI | InChI=1S/C30H33NO4/c32-28-18-10-17-26-29(34-21-24-13-6-2-7-14-24)30(35-22-25-15-8-3-9-16-25)27(19-31(26)28)33-20-23-11-4-1-5-12-23/h1-9,11-16,26-27,29-30H,10,17-22H2/t26-,27?,29-,30-/m1/s1 |
| InChIKey | GCOUNIJNRLJDBH-QFMRDJFXSA-N |
| XLogP | 5.14 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |