C30H36O8 — CID 10839799
[(1R,2S,5S,6R,9R,12S,13R,17S,18S,20R)-6-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-6,13-dimethyl-8,14-dioxo-7,19-dioxahexacyclo[10.9.0.02,9.05,9.013,18.018,20]henicos-15-en-17-yl] acetate (PubChem CID 10839799) has the molecular formula C30H36O8 and a molecular weight of 524.61 g/mol. Its IUPAC name is [(1R,2S,5S,6R,9R,12S,13R,17S,18S,20R)-6-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-6,13-dimethyl-8,14-dioxo-7,19-dioxahexacyclo[10.9.0.02,9.05,9.013,18.018,20]henicos-15-en-17-yl] acetate.
| Compound Name | [(1R,2S,5S,6R,9R,12S,13R,17S,18S,20R)-6-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-6,13-dimethyl-8,14-dioxo-7,19-dioxahexacyclo[10.9.0.02,9.05,9.013,18.018,20]henicos-15-en-17-yl] acetate |
|---|---|
| PubChem CID | 10839799 |
| Molecular Formula | C30H36O8 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | [(1R,2S,5S,6R,9R,12S,13R,17S,18S,20R)-6-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-6,13-dimethyl-8,14-dioxo-7,19-dioxahexacyclo[10.9.0.02,9.05,9.013,18.018,20]henicos-15-en-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=CC(=O)[C@]2(C)[C@H]3CC[C@]45C(=O)O[C@@](C)(C6CC(C)=C(C)C(=O)O6)[C@H]4CC[C@H]5[C@@H]3C[C@H]3O[C@]132 |
| InChI | InChI=1S/C30H36O8/c1-14-12-23(36-25(33)15(14)2)28(5)20-7-6-19-17-13-24-30(37-24)22(35-16(3)31)9-8-21(32)27(30,4)18(17)10-11-29(19,20)26(34)38-28/h8-9,17-20,22-24H,6-7,10-13H2,1-5H3/t17-,18+,19+,20-,22+,23?,24-,27+,28-,29-,30-/m1/s1 |
| InChIKey | IEABCZXUVAYIAD-QKJCTDNMSA-N |
| XLogP | 3.61 |
| TPSA | 108.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|