C28H34O6 — CID 163070009
(1S,2R,5R,6R,9S,12S,13R,18S,20R)-6-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-6,13-dimethyl-7,19-dioxahexacyclo[10.9.0.02,9.05,9.013,18.018,20]henicos-15-ene-8,14-dione (PubChem CID 163070009) has the molecular formula C28H34O6 and a molecular weight of 466.57 g/mol. Its IUPAC name is (1S,2R,5R,6R,9S,12S,13R,18S,20R)-6-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-6,13-dimethyl-7,19-dioxahexacyclo[10.9.0.02,9.05,9.013,18.018,20]henicos-15-ene-8,14-dione.
| Compound Name | (1S,2R,5R,6R,9S,12S,13R,18S,20R)-6-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-6,13-dimethyl-7,19-dioxahexacyclo[10.9.0.02,9.05,9.013,18.018,20]henicos-15-ene-8,14-dione |
|---|---|
| PubChem CID | 163070009 |
| Molecular Formula | C28H34O6 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | (1S,2R,5R,6R,9S,12S,13R,18S,20R)-6-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-6,13-dimethyl-7,19-dioxahexacyclo[10.9.0.02,9.05,9.013,18.018,20]henicos-15-ene-8,14-dione |
| SMILES | CC1=C(C)C(=O)O[C@@H]([C@]2(C)OC(=O)[C@@]34CC[C@H]5[C@H](C[C@H]6O[C@]67CC=CC(=O)[C@]57C)[C@H]3CC[C@@H]24)C1 |
| InChI | InChI=1S/C28H34O6/c1-14-12-21(32-23(30)15(14)2)26(4)19-8-7-18-16-13-22-28(33-22)10-5-6-20(29)25(28,3)17(16)9-11-27(18,19)24(31)34-26/h5-6,16-19,21-22H,7-13H2,1-4H3/t16-,17-,18+,19-,21+,22+,25-,26+,27-,28+/m0/s1 |
| InChIKey | MPKGUEFNXPRBLR-YWGPJMLVSA-N |
| XLogP | 4.07 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|