C21H25N7O10 — CID 10840050
[(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-5-(hydroxymethyl)-4-methoxyoxolan-3-yl] 2-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]acetate (PubChem CID 10840050) has the molecular formula C21H25N7O10 and a molecular weight of 535.47 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-5-(hydroxymethyl)-4-methoxyoxolan-3-yl] 2-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]acetate.
| Compound Name | [(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-5-(hydroxymethyl)-4-methoxyoxolan-3-yl] 2-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]acetate |
|---|---|
| PubChem CID | 10840050 |
| Molecular Formula | C21H25N7O10 |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-5-(hydroxymethyl)-4-methoxyoxolan-3-yl] 2-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]acetate |
| SMILES | CO[C@H]1[C@@H](OC(=O)C[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C21H25N7O10/c1-35-15-9(5-29)37-20(27-3-2-10(30)26-21(27)34)16(15)38-11(31)4-8-13(32)14(33)19(36-8)28-7-25-12-17(22)23-6-24-18(12)28/h2-3,6-9,13-16,19-20,29,32-33H,4-5H2,1H3,(H2,22,23,24)(H,26,30,34)/t8-,9-,13-,14-,15-,16-,19-,20-/m1/s1 |
| InChIKey | QHNBINKDRACNIZ-UFEARPIISA-N |
| XLogP | -3.22 |
| TPSA | 239.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |