C9H8ClN3S — CID 1084009
5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-amine (PubChem CID 1084009) has the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-amine.
| Compound Name | 5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-amine |
|---|---|
| PubChem CID | 1084009 |
| Molecular Formula | C9H8ClN3S |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-amine |
| SMILES | NC1=NN=C(c2ccc(Cl)cc2)CS1 |
| InChI | InChI=1S/C9H8ClN3S/c10-7-3-1-6(2-4-7)8-5-14-9(11)13-12-8/h1-4H,5H2,(H2,11,13) |
| InChIKey | GIAOPTGPMKOUOK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |