C29H50O7Si — CID 10840140
tert-butyl-[2-[(4S,5S)-5-[(E,3S,5R)-3-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]hex-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane (PubChem CID 10840140) has the molecular formula C29H50O7Si and a molecular weight of 538.80 g/mol. Its IUPAC name is tert-butyl-[2-[(4S,5S)-5-[(E,3S,5R)-3-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]hex-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(4S,5S)-5-[(E,3S,5R)-3-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]hex-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10840140 |
| Molecular Formula | C29H50O7Si |
| Molecular Weight | 538.80 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | tert-butyl-[2-[(4S,5S)-5-[(E,3S,5R)-3-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]hex-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane |
| SMILES | COCO[C@H](/C=C/[C@@H]1OC(C)(C)O[C@H]1CCO[Si](C)(C)C(C)(C)C)C[C@@H](C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C29H50O7Si/c1-22(32-20-23-11-13-24(31-8)14-12-23)19-25(33-21-30-7)15-16-26-27(36-29(5,6)35-26)17-18-34-37(9,10)28(2,3)4/h11-16,22,25-27H,17-21H2,1-10H3/b16-15+/t22-,25-,26+,27+/m1/s1 |
| InChIKey | CZZVTPDPSXRHRS-LYYSHXAFSA-N |
| XLogP | 6.47 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.80 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|