C42H32N8 — CID 10841939
1-[1,3,4,5,6,7,8-hepta(pyrrol-1-yl)naphthalen-2-yl]pyrrole (PubChem CID 10841939) has the molecular formula C42H32N8 and a molecular weight of 648.77 g/mol. Its IUPAC name is 1-[1,3,4,5,6,7,8-hepta(pyrrol-1-yl)naphthalen-2-yl]pyrrole.
| Compound Name | 1-[1,3,4,5,6,7,8-hepta(pyrrol-1-yl)naphthalen-2-yl]pyrrole |
|---|---|
| PubChem CID | 10841939 |
| Molecular Formula | C42H32N8 |
| Molecular Weight | 648.77 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | 1-[1,3,4,5,6,7,8-hepta(pyrrol-1-yl)naphthalen-2-yl]pyrrole |
| SMILES | c1ccn(-c2c(-n3cccc3)c(-n3cccc3)c3c(-n4cccc4)c(-n4cccc4)c(-n4cccc4)c(-n4cccc4)c3c2-n2cccc2)c1 |
| InChI | InChI=1S/C42H32N8/c1-2-18-43(17-1)35-33-34(37(45-21-5-6-22-45)40(48-27-11-12-28-48)39(35)47-25-9-10-26-47)38(46-23-7-8-24-46)42(50-31-15-16-32-50)41(49-29-13-14-30-49)36(33)44-19-3-4-20-44/h1-32H |
| InChIKey | ACOLQSWJLCEXJQ-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.77 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |