C40H36N2O2S4 — CID 10842473
(3S,4R)-1-benzyl-3-[[(3S,4R)-1-benzyl-3-ethylsulfanyl-2-oxo-4-(2-phenylethynyl)azetidin-3-yl]disulfanyl]-3-ethylsulfanyl-4-(2-phenylethynyl)azetidin-2-one (PubChem CID 10842473) has the molecular formula C40H36N2O2S4 and a molecular weight of 705.01 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-3-[[(3S,4R)-1-benzyl-3-ethylsulfanyl-2-oxo-4-(2-phenylethynyl)azetidin-3-yl]disulfanyl]-3-ethylsulfanyl-4-(2-phenylethynyl)azetidin-2-one.
| Compound Name | (3S,4R)-1-benzyl-3-[[(3S,4R)-1-benzyl-3-ethylsulfanyl-2-oxo-4-(2-phenylethynyl)azetidin-3-yl]disulfanyl]-3-ethylsulfanyl-4-(2-phenylethynyl)azetidin-2-one |
|---|---|
| PubChem CID | 10842473 |
| Molecular Formula | C40H36N2O2S4 |
| Molecular Weight | 705.01 g/mol |
| Exact Mass | 704.17 |
| IUPAC Name | (3S,4R)-1-benzyl-3-[[(3S,4R)-1-benzyl-3-ethylsulfanyl-2-oxo-4-(2-phenylethynyl)azetidin-3-yl]disulfanyl]-3-ethylsulfanyl-4-(2-phenylethynyl)azetidin-2-one |
| SMILES | CCS[C@@]1(SS[C@]2(SCC)C(=O)N(Cc3ccccc3)[C@@H]2C#Cc2ccccc2)C(=O)N(Cc2ccccc2)[C@@H]1C#Cc1ccccc1 |
| InChI | InChI=1S/C40H36N2O2S4/c1-3-45-39(35(27-25-31-17-9-5-10-18-31)41(37(39)43)29-33-21-13-7-14-22-33)47-48-40(46-4-2)36(28-26-32-19-11-6-12-20-32)42(38(40)44)30-34-23-15-8-16-24-34/h5-24,35-36H,3-4,29-30H2,1-2H3/t35-,36-,39+,40+/m1/s1 |
| InChIKey | PUKUIEDSWZVGFO-JFDQHVTASA-N |
| XLogP | 8.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.01 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|