C17H23NSe — CID 10844272
(2E)-N,N,3-triethyl-2-phenylpenta-2,4-dieneselenoamide (PubChem CID 10844272) has the molecular formula C17H23NSe and a molecular weight of 320.34 g/mol. Its IUPAC name is (2E)-N,N,3-triethyl-2-phenylpenta-2,4-dieneselenoamide.
| Compound Name | (2E)-N,N,3-triethyl-2-phenylpenta-2,4-dieneselenoamide |
|---|---|
| PubChem CID | 10844272 |
| Molecular Formula | C17H23NSe |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (2E)-N,N,3-triethyl-2-phenylpenta-2,4-dieneselenoamide |
| SMILES | C=C/C(CC)=C(/C(=[Se])N(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C17H23NSe/c1-5-14(6-2)16(15-12-10-9-11-13-15)17(19)18(7-3)8-4/h5,9-13H,1,6-8H2,2-4H3/b16-14- |
| InChIKey | DTTYRPDZRXCAEE-PEZBUJJGSA-N |
| XLogP | 3.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|