C10H18O2 — CID 10844877
trans-(1S,2R)-2-but-3-enyl-2-(hydroxymethyl)cyclopentan-1-ol (PubChem CID 10844877) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is trans-(1S,2R)-2-but-3-enyl-2-(hydroxymethyl)cyclopentan-1-ol.
| Compound Name | trans-(1S,2R)-2-but-3-enyl-2-(hydroxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 10844877 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | trans-(1S,2R)-2-but-3-enyl-2-(hydroxymethyl)cyclopentan-1-ol |
| SMILES | C=CCC[C@@]1(CO)CCC[C@@H]1O |
| InChI | InChI=1S/C10H18O2/c1-2-3-6-10(8-11)7-4-5-9(10)12/h2,9,11-12H,1,3-8H2/t9-,10-/m0/s1 |
| InChIKey | XJVVIQJSOOHXTG-UWVGGRQHSA-N |
| XLogP | 1.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|