C11H10FNO2 — CID 10845982
3-[(3-fluorophenyl)methylamino]-4-hydroxycyclobut-2-en-1-one (PubChem CID 10845982) has the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methylamino]-4-hydroxycyclobut-2-en-1-one.
| Compound Name | 3-[(3-fluorophenyl)methylamino]-4-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10845982 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 3-[(3-fluorophenyl)methylamino]-4-hydroxycyclobut-2-en-1-one |
| SMILES | O=C1C=C(NCc2cccc(F)c2)C1O |
| InChI | InChI=1S/C11H10FNO2/c12-8-3-1-2-7(4-8)6-13-9-5-10(14)11(9)15/h1-5,11,13,15H,6H2 |
| InChIKey | XHTHMBODSUTVGP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |