C13H26OSi — CID 10846938
tert-butyl-[[(1S,6S,7S)-7-deuterio-1-bicyclo[4.1.0]heptanyl]oxy]-dimethylsilane (PubChem CID 10846938) has the molecular formula C13H26OSi and a molecular weight of 227.44 g/mol. Its IUPAC name is tert-butyl-[[(1S,6S,7S)-7-deuterio-1-bicyclo[4.1.0]heptanyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,6S,7S)-7-deuterio-1-bicyclo[4.1.0]heptanyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 10846938 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.18 |
| IUPAC Name | tert-butyl-[[(1S,6S,7S)-7-deuterio-1-bicyclo[4.1.0]heptanyl]oxy]-dimethylsilane |
| SMILES | [2H][C@H]1[C@@H]2CCCC[C@]12O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26OSi/c1-12(2,3)15(4,5)14-13-9-7-6-8-11(13)10-13/h11H,6-10H2,1-5H3/t11-,13-/m0/s1/i10D/t10-,11-,13- |
| InChIKey | RYRWFMUJGAIFHQ-OLNGHKTCSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|