C24H48O3Si — CID 69232296
(2R)-2-[(1R,3aR,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-yl]-6-methylheptane-1,6-diol (PubChem CID 69232296) has the molecular formula C24H48O3Si and a molecular weight of 412.73 g/mol. Its IUPAC name is (2R)-2-[(1R,3aR,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-yl]-6-methylheptane-1,6-diol.
| Compound Name | (2R)-2-[(1R,3aR,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-yl]-6-methylheptane-1,6-diol |
|---|---|
| PubChem CID | 69232296 |
| Molecular Formula | C24H48O3Si |
| Molecular Weight | 412.73 g/mol |
| Exact Mass | 412.34 |
| IUPAC Name | (2R)-2-[(1R,3aR,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-yl]-6-methylheptane-1,6-diol |
| SMILES | CC(C)(O)CCC[C@H](CO)[C@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2CCCC[C@]21C |
| InChI | InChI=1S/C24H48O3Si/c1-21(2,3)28(7,8)27-24(20(18-25)13-11-15-22(4,5)26)17-14-19-12-9-10-16-23(19,24)6/h19-20,25-26H,9-18H2,1-8H3/t19-,20-,23-,24-/m1/s1 |
| InChIKey | LOFHWHGFQWBEAR-FAYOUJPWSA-N |
| XLogP | 6.29 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.73 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|