C12H22O4 — CID 10847063
3-[(1R,2S,5S)-1-hydroxy-2-(hydroxymethyl)-5-methylcyclopentyl]propyl acetate (PubChem CID 10847063) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 3-[(1R,2S,5S)-1-hydroxy-2-(hydroxymethyl)-5-methylcyclopentyl]propyl acetate.
| Compound Name | 3-[(1R,2S,5S)-1-hydroxy-2-(hydroxymethyl)-5-methylcyclopentyl]propyl acetate |
|---|---|
| PubChem CID | 10847063 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 3-[(1R,2S,5S)-1-hydroxy-2-(hydroxymethyl)-5-methylcyclopentyl]propyl acetate |
| SMILES | CC(=O)OCCC[C@]1(O)[C@H](CO)CC[C@@H]1C |
| InChI | InChI=1S/C12H22O4/c1-9-4-5-11(8-13)12(9,15)6-3-7-16-10(2)14/h9,11,13,15H,3-8H2,1-2H3/t9-,11-,12+/m0/s1 |
| InChIKey | QNSXPDHPTSHZAX-ZMLRMANQSA-N |
| XLogP | 1.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|