C21H32O6 — CID 135038537
3-[(1R,2S,6R,7R,8R)-8-acetyloxy-2,3,7-trimethyl-12-oxo-11-oxatricyclo[5.3.2.01,6]dodecan-2-yl]propyl acetate (PubChem CID 135038537) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 3-[(1R,2S,6R,7R,8R)-8-acetyloxy-2,3,7-trimethyl-12-oxo-11-oxatricyclo[5.3.2.01,6]dodecan-2-yl]propyl acetate.
| Compound Name | 3-[(1R,2S,6R,7R,8R)-8-acetyloxy-2,3,7-trimethyl-12-oxo-11-oxatricyclo[5.3.2.01,6]dodecan-2-yl]propyl acetate |
|---|---|
| PubChem CID | 135038537 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 3-[(1R,2S,6R,7R,8R)-8-acetyloxy-2,3,7-trimethyl-12-oxo-11-oxatricyclo[5.3.2.01,6]dodecan-2-yl]propyl acetate |
| SMILES | CC(=O)OCCC[C@@]1(C)C(C)CC[C@@H]2[C@@]3(C)C(=O)O[C@]21CC[C@H]3OC(C)=O |
| InChI | InChI=1S/C21H32O6/c1-13-7-8-16-20(5)17(26-15(3)23)9-11-21(16,27-18(20)24)19(13,4)10-6-12-25-14(2)22/h13,16-17H,6-12H2,1-5H3/t13?,16-,17-,19+,20-,21-/m1/s1 |
| InChIKey | VSQLNUDABPISNC-WWUGGLQFSA-N |
| XLogP | 3.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|