C22H30O6 — CID 163040635
[(1S,3R,6R,7R,8R)-2,2,8-trimethyl-12-oxo-7-[2-(5-oxo-2H-furan-4-yl)ethyl]-11-oxatricyclo[5.3.2.01,6]dodecan-3-yl] acetate (PubChem CID 163040635) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is [(1S,3R,6R,7R,8R)-2,2,8-trimethyl-12-oxo-7-[2-(5-oxo-2H-furan-4-yl)ethyl]-11-oxatricyclo[5.3.2.01,6]dodecan-3-yl] acetate.
| Compound Name | [(1S,3R,6R,7R,8R)-2,2,8-trimethyl-12-oxo-7-[2-(5-oxo-2H-furan-4-yl)ethyl]-11-oxatricyclo[5.3.2.01,6]dodecan-3-yl] acetate |
|---|---|
| PubChem CID | 163040635 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | [(1S,3R,6R,7R,8R)-2,2,8-trimethyl-12-oxo-7-[2-(5-oxo-2H-furan-4-yl)ethyl]-11-oxatricyclo[5.3.2.01,6]dodecan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@H]2[C@]3(CCC4=CCOC4=O)C(=O)O[C@]2(CC[C@H]3C)C1(C)C |
| InChI | InChI=1S/C22H30O6/c1-13-7-11-22-16(5-6-17(20(22,3)4)27-14(2)23)21(13,19(25)28-22)10-8-15-9-12-26-18(15)24/h9,13,16-17H,5-8,10-12H2,1-4H3/t13-,16-,17-,21-,22+/m1/s1 |
| InChIKey | ZEXXSAAZIFOGPU-DPMXDKJQSA-N |
| XLogP | 3.33 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|