C23H38O5Si — CID 134866505
methyl (1R,5S,8aS)-5-(3-acetyloxypropyl)-1,5,6-trimethyl-3-trimethylsilyloxy-6,7,8,8a-tetrahydronaphthalene-1-carboxylate (PubChem CID 134866505) has the molecular formula C23H38O5Si and a molecular weight of 422.64 g/mol. Its IUPAC name is methyl (1R,5S,8aS)-5-(3-acetyloxypropyl)-1,5,6-trimethyl-3-trimethylsilyloxy-6,7,8,8a-tetrahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1R,5S,8aS)-5-(3-acetyloxypropyl)-1,5,6-trimethyl-3-trimethylsilyloxy-6,7,8,8a-tetrahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 134866505 |
| Molecular Formula | C23H38O5Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | methyl (1R,5S,8aS)-5-(3-acetyloxypropyl)-1,5,6-trimethyl-3-trimethylsilyloxy-6,7,8,8a-tetrahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C=C(O[Si](C)(C)C)C=C2[C@@H]1CCC(C)[C@]2(C)CCCOC(C)=O |
| InChI | InChI=1S/C23H38O5Si/c1-16-10-11-19-20(22(16,3)12-9-13-27-17(2)24)14-18(28-29(6,7)8)15-23(19,4)21(25)26-5/h14-16,19H,9-13H2,1-8H3/t16?,19-,22-,23-/m0/s1 |
| InChIKey | JTADCJUSQRQBPP-FXOHPGFLSA-N |
| XLogP | 5.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|