C25H40O6 — CID 102066693
methyl (1R,5R,6S,8aR)-3-acetyloxy-5-[(3S)-5-acetyloxy-3-methylpentyl]-1,5,6-trimethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylate (PubChem CID 102066693) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is methyl (1R,5R,6S,8aR)-3-acetyloxy-5-[(3S)-5-acetyloxy-3-methylpentyl]-1,5,6-trimethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1R,5R,6S,8aR)-3-acetyloxy-5-[(3S)-5-acetyloxy-3-methylpentyl]-1,5,6-trimethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 102066693 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | methyl (1R,5R,6S,8aR)-3-acetyloxy-5-[(3S)-5-acetyloxy-3-methylpentyl]-1,5,6-trimethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CC(OC(C)=O)C=C2[C@H]1CC[C@H](C)[C@@]2(C)CC[C@H](C)CCOC(C)=O |
| InChI | InChI=1S/C25H40O6/c1-16(11-13-30-18(3)26)10-12-24(5)17(2)8-9-21-22(24)14-20(31-19(4)27)15-25(21,6)23(28)29-7/h14,16-17,20-21H,8-13,15H2,1-7H3/t16-,17-,20?,21+,24+,25+/m0/s1 |
| InChIKey | FTDJDSZKDUKGMD-KDPVBLSUSA-N |
| XLogP | 4.85 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|