C26H42O7 — CID 73197790
[5-(1-acetyl-2,5-diacetyloxy-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydroinden-1-yl)-3-methylpentyl] acetate (PubChem CID 73197790) has the molecular formula C26H42O7 and a molecular weight of 466.62 g/mol. Its IUPAC name is [5-(1-acetyl-2,5-diacetyloxy-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydroinden-1-yl)-3-methylpentyl] acetate.
| Compound Name | [5-(1-acetyl-2,5-diacetyloxy-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydroinden-1-yl)-3-methylpentyl] acetate |
|---|---|
| PubChem CID | 73197790 |
| Molecular Formula | C26H42O7 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | [5-(1-acetyl-2,5-diacetyloxy-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydroinden-1-yl)-3-methylpentyl] acetate |
| SMILES | CC(=O)OCCC(C)CCC1(C(C)=O)C(OC(C)=O)CC2C(C)(C)C(OC(C)=O)CCC21C |
| InChI | InChI=1S/C26H42O7/c1-16(11-14-31-18(3)28)9-13-26(17(2)27)23(33-20(5)30)15-21-24(6,7)22(32-19(4)29)10-12-25(21,26)8/h16,21-23H,9-15H2,1-8H3 |
| InChIKey | LPOZLPZWCPNMFZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|