C26H41IO2 — CID 89232810
[(1S,3R,6S,12S,16R)-15-(2-iodoethyl)-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate (PubChem CID 89232810) has the molecular formula C26H41IO2 and a molecular weight of 512.52 g/mol. Its IUPAC name is [(1S,3R,6S,12S,16R)-15-(2-iodoethyl)-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate.
| Compound Name | [(1S,3R,6S,12S,16R)-15-(2-iodoethyl)-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
|---|---|
| PubChem CID | 89232810 |
| Molecular Formula | C26H41IO2 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | [(1S,3R,6S,12S,16R)-15-(2-iodoethyl)-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]23C[C@]24CC[C@]2(C)C(CCI)CC[C@@]2(C)C4CCC3C1(C)C |
| InChI | InChI=1S/C26H41IO2/c1-17(28)29-21-9-12-25-16-26(25)14-13-23(4)18(10-15-27)8-11-24(23,5)20(26)7-6-19(25)22(21,2)3/h18-21H,6-16H2,1-5H3/t18?,19?,20?,21-,23+,24-,25+,26-/m0/s1 |
| InChIKey | HBJLCMFYQSASEW-IHFXFFOMSA-N |
| XLogP | 7.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|