C10H14O5 — CID 138516686
3-(4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)propyl acetate (PubChem CID 138516686) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-(4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)propyl acetate.
| Compound Name | 3-(4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)propyl acetate |
|---|---|
| PubChem CID | 138516686 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-(4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)propyl acetate |
| SMILES | C=C1OC(=O)OC1(C)CCCOC(C)=O |
| InChI | InChI=1S/C10H14O5/c1-7-10(3,15-9(12)14-7)5-4-6-13-8(2)11/h1,4-6H2,2-3H3 |
| InChIKey | JYMMLNDMGCFVCT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|