C17H24O6 — CID 164622494
[(4S)-4-[(1aR,2aR,5aS,6S,6aS)-6-hydroxy-1a-methyl-5-methylidene-4-oxo-2,2a,5a,6-tetrahydrooxireno[2,3-f][1]benzofuran-6a-yl]pentyl] acetate (PubChem CID 164622494) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is [(4S)-4-[(1aR,2aR,5aS,6S,6aS)-6-hydroxy-1a-methyl-5-methylidene-4-oxo-2,2a,5a,6-tetrahydrooxireno[2,3-f][1]benzofuran-6a-yl]pentyl] acetate.
| Compound Name | [(4S)-4-[(1aR,2aR,5aS,6S,6aS)-6-hydroxy-1a-methyl-5-methylidene-4-oxo-2,2a,5a,6-tetrahydrooxireno[2,3-f][1]benzofuran-6a-yl]pentyl] acetate |
|---|---|
| PubChem CID | 164622494 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [(4S)-4-[(1aR,2aR,5aS,6S,6aS)-6-hydroxy-1a-methyl-5-methylidene-4-oxo-2,2a,5a,6-tetrahydrooxireno[2,3-f][1]benzofuran-6a-yl]pentyl] acetate |
| SMILES | C=C1C(=O)O[C@@H]2C[C@@]3(C)O[C@@]3([C@@H](C)CCCOC(C)=O)[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C17H24O6/c1-9(6-5-7-21-11(3)18)17-14(19)13-10(2)15(20)22-12(13)8-16(17,4)23-17/h9,12-14,19H,2,5-8H2,1,3-4H3/t9-,12+,13+,14-,16+,17-/m0/s1 |
| InChIKey | CCYLUFRCDNXVLC-UVYGVSRESA-N |
| XLogP | 1.36 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|