C19H25ClO6 — CID 164623290
[(4S)-4-[(3aR,4S,7aR)-4-acetyloxy-5-chloro-3,6-dimethylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-5-yl]pentyl] acetate (PubChem CID 164623290) has the molecular formula C19H25ClO6 and a molecular weight of 384.86 g/mol. Its IUPAC name is [(4S)-4-[(3aR,4S,7aR)-4-acetyloxy-5-chloro-3,6-dimethylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-5-yl]pentyl] acetate.
| Compound Name | [(4S)-4-[(3aR,4S,7aR)-4-acetyloxy-5-chloro-3,6-dimethylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-5-yl]pentyl] acetate |
|---|---|
| PubChem CID | 164623290 |
| Molecular Formula | C19H25ClO6 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | [(4S)-4-[(3aR,4S,7aR)-4-acetyloxy-5-chloro-3,6-dimethylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-5-yl]pentyl] acetate |
| SMILES | C=C1C(=O)O[C@@H]2CC(=C)C(Cl)([C@@H](C)CCCOC(C)=O)[C@@H](OC(C)=O)[C@H]12 |
| InChI | InChI=1S/C19H25ClO6/c1-10(7-6-8-24-13(4)21)19(20)11(2)9-15-16(12(3)18(23)26-15)17(19)25-14(5)22/h10,15-17H,2-3,6-9H2,1,4-5H3/t10-,15+,16+,17-,19?/m0/s1 |
| InChIKey | AIJMQAXUTKHOLO-MIBAMZGGSA-N |
| XLogP | 2.93 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|