C34H42O9 — CID 75600832
4-[5-(11-acetyloxy-9,17-dimethyl-4-methylidene-5,15-dioxo-6,16-dioxatetracyclo[8.7.0.03,7.012,17]heptadec-1(10)-en-14-yl)-2-(hydroxymethyl)phenyl]pentyl acetate (PubChem CID 75600832) has the molecular formula C34H42O9 and a molecular weight of 594.70 g/mol. Its IUPAC name is 4-[5-(11-acetyloxy-9,17-dimethyl-4-methylidene-5,15-dioxo-6,16-dioxatetracyclo[8.7.0.03,7.012,17]heptadec-1(10)-en-14-yl)-2-(hydroxymethyl)phenyl]pentyl acetate.
| Compound Name | 4-[5-(11-acetyloxy-9,17-dimethyl-4-methylidene-5,15-dioxo-6,16-dioxatetracyclo[8.7.0.03,7.012,17]heptadec-1(10)-en-14-yl)-2-(hydroxymethyl)phenyl]pentyl acetate |
|---|---|
| PubChem CID | 75600832 |
| Molecular Formula | C34H42O9 |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 4-[5-(11-acetyloxy-9,17-dimethyl-4-methylidene-5,15-dioxo-6,16-dioxatetracyclo[8.7.0.03,7.012,17]heptadec-1(10)-en-14-yl)-2-(hydroxymethyl)phenyl]pentyl acetate |
| SMILES | C=C1C(=O)OC2CC(C)C3=C(CC12)C1(C)OC(=O)C(c2ccc(CO)c(C(C)CCCOC(C)=O)c2)CC1C3OC(C)=O |
| InChI | InChI=1S/C34H42O9/c1-17(8-7-11-40-20(4)36)24-13-22(9-10-23(24)16-35)26-15-28-31(41-21(5)37)30-18(2)12-29-25(19(3)32(38)42-29)14-27(30)34(28,6)43-33(26)39/h9-10,13,17-18,25-26,28-29,31,35H,3,7-8,11-12,14-16H2,1-2,4-6H3 |
| InChIKey | GUMFRZZBZIMZFK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|