C23H30O8 — CID 162890374
[(3aS,4S,7aR)-4-acetyloxy-5-[(2S)-5-acetyloxypentan-2-yl]-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-6-yl]methyl 2-methylprop-2-enoate (PubChem CID 162890374) has the molecular formula C23H30O8 and a molecular weight of 434.49 g/mol. Its IUPAC name is [(3aS,4S,7aR)-4-acetyloxy-5-[(2S)-5-acetyloxypentan-2-yl]-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-6-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [(3aS,4S,7aR)-4-acetyloxy-5-[(2S)-5-acetyloxypentan-2-yl]-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-6-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162890374 |
| Molecular Formula | C23H30O8 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | [(3aS,4S,7aR)-4-acetyloxy-5-[(2S)-5-acetyloxypentan-2-yl]-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-6-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1=C([C@@H](C)CCCOC(C)=O)[C@@H](OC(C)=O)[C@H]2C(=C)C(=O)O[C@@H]2C1 |
| InChI | InChI=1S/C23H30O8/c1-12(2)22(26)29-11-17-10-18-20(14(4)23(27)31-18)21(30-16(6)25)19(17)13(3)8-7-9-28-15(5)24/h13,18,20-21H,1,4,7-11H2,2-3,5-6H3/t13-,18+,20-,21+/m0/s1 |
| InChIKey | VPJMROMQABPDGC-NHOOAETJSA-N |
| XLogP | 2.81 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|