C21H32O5 — CID 163147214
[(3aR,7aR)-5-[(2S)-5-hydroxypentan-2-yl]-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-6-yl]methyl (3R)-3-methylpentanoate (PubChem CID 163147214) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is [(3aR,7aR)-5-[(2S)-5-hydroxypentan-2-yl]-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-6-yl]methyl (3R)-3-methylpentanoate.
| Compound Name | [(3aR,7aR)-5-[(2S)-5-hydroxypentan-2-yl]-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-6-yl]methyl (3R)-3-methylpentanoate |
|---|---|
| PubChem CID | 163147214 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | [(3aR,7aR)-5-[(2S)-5-hydroxypentan-2-yl]-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-6-yl]methyl (3R)-3-methylpentanoate |
| SMILES | C=C1C(=O)O[C@@H]2CC(COC(=O)C[C@H](C)CC)=C([C@@H](C)CCCO)C[C@H]12 |
| InChI | InChI=1S/C21H32O5/c1-5-13(2)9-20(23)25-12-16-10-19-18(15(4)21(24)26-19)11-17(16)14(3)7-6-8-22/h13-14,18-19,22H,4-12H2,1-3H3/t13-,14+,18-,19-/m1/s1 |
| InChIKey | MASVCCDXOUYRBD-GTYSZEQSSA-N |
| XLogP | 3.56 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|