C23H29N3O8 — CID 164625993
methyl 1-[(3aS,4S,7R,7aS)-4-acetyloxy-5-[(2S)-5-acetyloxypentan-2-yl]-6-methyl-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-7-yl]triazole-4-carboxylate (PubChem CID 164625993) has the molecular formula C23H29N3O8 and a molecular weight of 475.50 g/mol. Its IUPAC name is methyl 1-[(3aS,4S,7R,7aS)-4-acetyloxy-5-[(2S)-5-acetyloxypentan-2-yl]-6-methyl-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-7-yl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(3aS,4S,7R,7aS)-4-acetyloxy-5-[(2S)-5-acetyloxypentan-2-yl]-6-methyl-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-7-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 164625993 |
| Molecular Formula | C23H29N3O8 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | methyl 1-[(3aS,4S,7R,7aS)-4-acetyloxy-5-[(2S)-5-acetyloxypentan-2-yl]-6-methyl-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-7-yl]triazole-4-carboxylate |
| SMILES | C=C1C(=O)O[C@H]2[C@@H]1[C@H](OC(C)=O)C([C@@H](C)CCCOC(C)=O)=C(C)[C@H]2n1cc(C(=O)OC)nn1 |
| InChI | InChI=1S/C23H29N3O8/c1-11(8-7-9-32-14(4)27)17-12(2)19(26-10-16(24-25-26)23(30)31-6)21-18(13(3)22(29)34-21)20(17)33-15(5)28/h10-11,18-21H,3,7-9H2,1-2,4-6H3/t11-,18-,19+,20+,21-/m0/s1 |
| InChIKey | INECTWLEGSIADB-GLBFEIIJSA-N |
| XLogP | 1.94 |
| TPSA | 135.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|