C23H28O6 — CID 164619114
[(4S)-4-[(4R,7aR)-4-hydroxy-3-[(4-hydroxyphenyl)methyl]-6-methyl-2-oxo-7,7a-dihydro-4H-1-benzofuran-5-yl]pentyl] acetate (PubChem CID 164619114) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is [(4S)-4-[(4R,7aR)-4-hydroxy-3-[(4-hydroxyphenyl)methyl]-6-methyl-2-oxo-7,7a-dihydro-4H-1-benzofuran-5-yl]pentyl] acetate.
| Compound Name | [(4S)-4-[(4R,7aR)-4-hydroxy-3-[(4-hydroxyphenyl)methyl]-6-methyl-2-oxo-7,7a-dihydro-4H-1-benzofuran-5-yl]pentyl] acetate |
|---|---|
| PubChem CID | 164619114 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [(4S)-4-[(4R,7aR)-4-hydroxy-3-[(4-hydroxyphenyl)methyl]-6-methyl-2-oxo-7,7a-dihydro-4H-1-benzofuran-5-yl]pentyl] acetate |
| SMILES | CC(=O)OCCC[C@H](C)C1=C(C)C[C@H]2OC(=O)C(Cc3ccc(O)cc3)=C2[C@@H]1O |
| InChI | InChI=1S/C23H28O6/c1-13(5-4-10-28-15(3)24)20-14(2)11-19-21(22(20)26)18(23(27)29-19)12-16-6-8-17(25)9-7-16/h6-9,13,19,22,25-26H,4-5,10-12H2,1-3H3/t13-,19+,22+/m0/s1 |
| InChIKey | XOVTYDVGHHLREV-NCNFXNTHSA-N |
| XLogP | 3.22 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|