C18H28O3 — CID 11254839
(1R,2S,3R,6S,7S)-2,3,7-trimethyl-2-(3-oxobutyl)-11-oxatricyclo[5.3.2.01,6]dodecan-12-one (PubChem CID 11254839) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (1R,2S,3R,6S,7S)-2,3,7-trimethyl-2-(3-oxobutyl)-11-oxatricyclo[5.3.2.01,6]dodecan-12-one.
| Compound Name | (1R,2S,3R,6S,7S)-2,3,7-trimethyl-2-(3-oxobutyl)-11-oxatricyclo[5.3.2.01,6]dodecan-12-one |
|---|---|
| PubChem CID | 11254839 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (1R,2S,3R,6S,7S)-2,3,7-trimethyl-2-(3-oxobutyl)-11-oxatricyclo[5.3.2.01,6]dodecan-12-one |
| SMILES | CC(=O)CC[C@@]1(C)[C@H](C)CC[C@H]2[C@]3(C)CCC[C@@]21OC3=O |
| InChI | InChI=1S/C18H28O3/c1-12-6-7-14-16(3)9-5-10-18(14,21-15(16)20)17(12,4)11-8-13(2)19/h12,14H,5-11H2,1-4H3/t12-,14+,16+,17+,18-/m1/s1 |
| InChIKey | GXOUDYPWOGQLSX-SHAWWILOSA-N |
| XLogP | 3.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |