C20H28O5 — CID 10405464
(1S,2S,5S,6R,8R,11R,12R)-5-hydroxy-6-(hydroxymethyl)-2,12-dimethyl-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecane-7,17-dione (PubChem CID 10405464) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (1S,2S,5S,6R,8R,11R,12R)-5-hydroxy-6-(hydroxymethyl)-2,12-dimethyl-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecane-7,17-dione.
| Compound Name | (1S,2S,5S,6R,8R,11R,12R)-5-hydroxy-6-(hydroxymethyl)-2,12-dimethyl-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecane-7,17-dione |
|---|---|
| PubChem CID | 10405464 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (1S,2S,5S,6R,8R,11R,12R)-5-hydroxy-6-(hydroxymethyl)-2,12-dimethyl-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecane-7,17-dione |
| SMILES | C[C@]12CC[C@]3(O)C[C@@]1(CC[C@@H]1[C@@]4(C)CCC[C@]12OC4=O)C(=O)[C@@H]3CO |
| InChI | InChI=1S/C20H28O5/c1-16-5-3-6-20(25-15(16)23)13(16)4-7-18-11-19(24,9-8-17(18,20)2)12(10-21)14(18)22/h12-13,21,24H,3-11H2,1-2H3/t12-,13+,16+,17-,18-,19-,20-/m0/s1 |
| InChIKey | ONOKZRNLDFPWDJ-DIBRSVBWSA-N |
| XLogP | 1.98 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |