C20H30O4 — CID 5458682
(1S,2S,6R,8R,9R,11R,12R)-6,9-dihydroxy-2,6,12-trimethyl-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecan-17-one (PubChem CID 5458682) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,2S,6R,8R,9R,11R,12R)-6,9-dihydroxy-2,6,12-trimethyl-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecan-17-one.
| Compound Name | (1S,2S,6R,8R,9R,11R,12R)-6,9-dihydroxy-2,6,12-trimethyl-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecan-17-one |
|---|---|
| PubChem CID | 5458682 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1S,2S,6R,8R,9R,11R,12R)-6,9-dihydroxy-2,6,12-trimethyl-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecan-17-one |
| SMILES | C[C@]12CCC3C[C@]1(C[C@@]3(C)O)[C@H](O)C[C@@H]1[C@@]3(C)CCC[C@]12OC3=O |
| InChI | InChI=1S/C20H30O4/c1-16-6-4-7-20(24-15(16)22)13(16)9-14(21)19-10-12(17(2,23)11-19)5-8-18(19,20)3/h12-14,21,23H,4-11H2,1-3H3/t12?,13-,14-,16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | LKNWRNYPVAXRTM-XBDFWGALSA-N |
| XLogP | 2.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |