About 4-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]aniline
4-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]aniline (PubChem CID 1084714) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is 4-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]aniline.
Molecular Properties
| Compound Name | 4-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]aniline |
| PubChem CID | 1084714 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 4-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]aniline |
| SMILES | C[C@@H]1CCC[C@H](C)N1Cc1ccc(N)cc1 |
| InChI | InChI=1S/C14H22N2/c1-11-4-3-5-12(2)16(11)10-13-6-8-14(15)9-7-13/h6-9,11-12H,3-5,10,15H2,1-2H3/t11-,12+ |
| InChIKey | OXTPGYNBWHJWOR-TXEJJXNPSA-N |
| XLogP | 3.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]aniline?
The IUPAC name of 4-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]aniline (CID 1084714) is 4-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]aniline.
What is the SMILES notation for 4-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]aniline?
The canonical SMILES for 4-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]aniline is C[C@@H]1CCC[C@H](C)N1Cc1ccc(N)cc1.
What is the InChIKey of 4-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]aniline?
The InChIKey is OXTPGYNBWHJWOR-TXEJJXNPSA-N. The full InChI is InChI=1S/C14H22N2/c1-11-4-3-5-12(2)16(11)10-13-6-8-14(15)9-7-13/h6-9,11-12H,3-5,10,15H2,1-2H3/t11-,12+.
What are the key properties of 4-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]aniline?
4-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]aniline has a molecular weight of 218.34 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]methyl]aniline is sourced from PubChem (CID 1084714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).