About 2-chloro-4-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]phenol
2-chloro-4-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]phenol (PubChem CID 103886816) has the molecular formula C14H20ClNO
and a molecular weight of 253.77 g/mol. Its IUPAC name is 2-chloro-4-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]phenol.
Molecular Properties
| Compound Name | 2-chloro-4-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]phenol |
| PubChem CID | 103886816 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-chloro-4-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]phenol |
| SMILES | C[C@@H]1CCC[C@H](C)N1Cc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClNO/c1-10-4-3-5-11(2)16(10)9-12-6-7-14(17)13(15)8-12/h6-8,10-11,17H,3-5,9H2,1-2H3/t10-,11+ |
| InChIKey | CKDQYLXZEKQTMV-PHIMTYICSA-N |
| XLogP | 3.81 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-4-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]phenol?
The IUPAC name of 2-chloro-4-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]phenol (CID 103886816) is 2-chloro-4-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]phenol.
What is the SMILES notation for 2-chloro-4-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]phenol?
The canonical SMILES for 2-chloro-4-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]phenol is C[C@@H]1CCC[C@H](C)N1Cc1ccc(O)c(Cl)c1.
What is the InChIKey of 2-chloro-4-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]phenol?
The InChIKey is CKDQYLXZEKQTMV-PHIMTYICSA-N. The full InChI is InChI=1S/C14H20ClNO/c1-10-4-3-5-11(2)16(10)9-12-6-7-14(17)13(15)8-12/h6-8,10-11,17H,3-5,9H2,1-2H3/t10-,11+.
What are the key properties of 2-chloro-4-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]phenol?
2-chloro-4-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]phenol has a molecular weight of 253.77 g/mol, XLogP of 3.81, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]phenol is sourced from PubChem (CID 103886816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).