C14H22O3 — CID 10847540
(2R,3aS,4S,5R,6aS)-4-methoxy-2-(1-methoxyethenyl)-2,5-dimethyl-3,3a,4,5,6,6a-hexahydropentalen-1-one (PubChem CID 10847540) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2R,3aS,4S,5R,6aS)-4-methoxy-2-(1-methoxyethenyl)-2,5-dimethyl-3,3a,4,5,6,6a-hexahydropentalen-1-one.
| Compound Name | (2R,3aS,4S,5R,6aS)-4-methoxy-2-(1-methoxyethenyl)-2,5-dimethyl-3,3a,4,5,6,6a-hexahydropentalen-1-one |
|---|---|
| PubChem CID | 10847540 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (2R,3aS,4S,5R,6aS)-4-methoxy-2-(1-methoxyethenyl)-2,5-dimethyl-3,3a,4,5,6,6a-hexahydropentalen-1-one |
| SMILES | C=C(OC)[C@@]1(C)C[C@@H]2[C@@H](OC)[C@H](C)C[C@@H]2C1=O |
| InChI | InChI=1S/C14H22O3/c1-8-6-10-11(12(8)17-5)7-14(3,13(10)15)9(2)16-4/h8,10-12H,2,6-7H2,1,3-5H3/t8-,10+,11+,12+,14-/m1/s1 |
| InChIKey | SNKJUNZLCIGPIF-CFIQKXEOSA-N |
| XLogP | 2.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|