C15H26O5 — CID 10779573
(2S,3aS,4S,5R,6aS)-4-methoxy-2,5-dimethyl-2-(trimethoxymethyl)-3,3a,4,5,6,6a-hexahydropentalen-1-one (PubChem CID 10779573) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is (2S,3aS,4S,5R,6aS)-4-methoxy-2,5-dimethyl-2-(trimethoxymethyl)-3,3a,4,5,6,6a-hexahydropentalen-1-one.
| Compound Name | (2S,3aS,4S,5R,6aS)-4-methoxy-2,5-dimethyl-2-(trimethoxymethyl)-3,3a,4,5,6,6a-hexahydropentalen-1-one |
|---|---|
| PubChem CID | 10779573 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (2S,3aS,4S,5R,6aS)-4-methoxy-2,5-dimethyl-2-(trimethoxymethyl)-3,3a,4,5,6,6a-hexahydropentalen-1-one |
| SMILES | CO[C@@H]1[C@H]2C[C@](C)(C(OC)(OC)OC)C(=O)[C@H]2C[C@H]1C |
| InChI | InChI=1S/C15H26O5/c1-9-7-10-11(12(9)17-3)8-14(2,13(10)16)15(18-4,19-5)20-6/h9-12H,7-8H2,1-6H3/t9-,10+,11+,12+,14+/m1/s1 |
| InChIKey | TVVJNJJBSHZHMO-FGPLHTHASA-N |
| XLogP | 1.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|