C15H25N3 — CID 10848112
(1R,4R,9R,10S)-9-butyl-10-methyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-5,8(12)-dien-6-amine (PubChem CID 10848112) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is (1R,4R,9R,10S)-9-butyl-10-methyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-5,8(12)-dien-6-amine.
| Compound Name | (1R,4R,9R,10S)-9-butyl-10-methyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-5,8(12)-dien-6-amine |
|---|---|
| PubChem CID | 10848112 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (1R,4R,9R,10S)-9-butyl-10-methyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-5,8(12)-dien-6-amine |
| SMILES | CCCC[C@H]1C2=C3[C@H](CC[C@H]3N=C(N)N2)C[C@@H]1C |
| InChI | InChI=1S/C15H25N3/c1-3-4-5-11-9(2)8-10-6-7-12-13(10)14(11)18-15(16)17-12/h9-12H,3-8H2,1-2H3,(H3,16,17,18)/t9-,10+,11+,12+/m0/s1 |
| InChIKey | QQRVSMQLZBVWKJ-IRCOFANPSA-N |
| XLogP | 2.78 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |